C21H34O4 — CID 10594033
methyl (1S,4aR,5S)-1,4a,6-trimethyl-5-[2-(2-oxooxolan-3-yl)ethyl]-2,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate (PubChem CID 10594033) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is methyl (1S,4aR,5S)-1,4a,6-trimethyl-5-[2-(2-oxooxolan-3-yl)ethyl]-2,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aR,5S)-1,4a,6-trimethyl-5-[2-(2-oxooxolan-3-yl)ethyl]-2,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 10594033 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | methyl (1S,4aR,5S)-1,4a,6-trimethyl-5-[2-(2-oxooxolan-3-yl)ethyl]-2,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@@]2(C)C1CCC(C)[C@@H]2CCC1CCOC1=O |
| InChI | InChI=1S/C21H34O4/c1-14-6-9-17-20(2,11-5-12-21(17,3)19(23)24-4)16(14)8-7-15-10-13-25-18(15)22/h14-17H,5-13H2,1-4H3/t14?,15?,16-,17?,20+,21-/m0/s1 |
| InChIKey | ZRFBDZGXQIKFNC-XPXCCGEHSA-N |
| XLogP | 4.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |