(5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate

C12H9F3O7S — CID 10594259

IUPAC(5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate
SMILESCOc1cc(OC)c2c(OS(=O)(=O)C(F)(F)F)cc(=O)oc2c1
InChIInChI=1S/C12H9F3O7S/c1-19-6-3-7(20-2)11-8(4-6)21-10(16)5-9(11)22-23(17,18)12(13,14)15/h3-5H,1-2H3
InChIKeyLOVKRKOIPOGDOC-UHFFFAOYSA-N
MW354.26 g/mol
LogP2.04
Rot. Bonds4

About (5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate

(5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate (PubChem CID 10594259) has the molecular formula C12H9F3O7S and a molecular weight of 354.26 g/mol. Its IUPAC name is (5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate.

Molecular Properties

Compound Name(5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate
PubChem CID10594259
Molecular FormulaC12H9F3O7S
Molecular Weight354.26 g/mol
Exact Mass354.00
IUPAC Name(5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate
SMILESCOc1cc(OC)c2c(OS(=O)(=O)C(F)(F)F)cc(=O)oc2c1
InChIInChI=1S/C12H9F3O7S/c1-19-6-3-7(20-2)11-8(4-6)21-10(16)5-9(11)22-23(17,18)12(13,14)15/h3-5H,1-2H3
InChIKeyLOVKRKOIPOGDOC-UHFFFAOYSA-N
XLogP2.04
TPSA92.04 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500354.26
LogP ≤ 52.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}

Analyze (5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate?
The IUPAC name of (5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate (CID 10594259) is (5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate.
What is the SMILES notation for (5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate?
The canonical SMILES for (5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate is COc1cc(OC)c2c(OS(=O)(=O)C(F)(F)F)cc(=O)oc2c1.
What is the InChIKey of (5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate?
The InChIKey is LOVKRKOIPOGDOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F3O7S/c1-19-6-3-7(20-2)11-8(4-6)21-10(16)5-9(11)22-23(17,18)12(13,14)15/h3-5H,1-2H3.
What are the key properties of (5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate?
(5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate has a molecular weight of 354.26 g/mol, XLogP of 2.04, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5,7-dimethoxy-2-oxochromen-4-yl) trifluoromethanesulfonate is sourced from PubChem (CID 10594259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).