C17H14FN3O5 — CID 10594610
7-fluoro-5-nitro-6-(3-phenylpropoxy)-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 10594610) has the molecular formula C17H14FN3O5 and a molecular weight of 359.31 g/mol. Its IUPAC name is 7-fluoro-5-nitro-6-(3-phenylpropoxy)-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 7-fluoro-5-nitro-6-(3-phenylpropoxy)-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 10594610 |
| Molecular Formula | C17H14FN3O5 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 7-fluoro-5-nitro-6-(3-phenylpropoxy)-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc(F)c(OCCCc3ccccc3)c([N+](=O)[O-])c2[nH]c1=O |
| InChI | InChI=1S/C17H14FN3O5/c18-11-9-12-13(20-17(23)16(22)19-12)14(21(24)25)15(11)26-8-4-7-10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2,(H,19,22)(H,20,23) |
| InChIKey | VNQLCFICOVVCGM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|