C20H18F2O2S — CID 10594681
6-(3,4-difluorophenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene (PubChem CID 10594681) has the molecular formula C20H18F2O2S and a molecular weight of 360.43 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene.
| Compound Name | 6-(3,4-difluorophenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene |
|---|---|
| PubChem CID | 10594681 |
| Molecular Formula | C20H18F2O2S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 6-(3,4-difluorophenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3ccc(F)c(F)c3)CC3(CC3)C2)cc1 |
| InChI | InChI=1S/C20H18F2O2S/c1-25(23,24)15-5-2-13(3-6-15)16-11-20(8-9-20)12-17(16)14-4-7-18(21)19(22)10-14/h2-7,10H,8-9,11-12H2,1H3 |
| InChIKey | LDHUBXLXUIFIHD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|