About tert-butyl (2S)-2-[(2R,3S)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]piperidine-1-carboxylate
tert-butyl (2S)-2-[(2R,3S)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]piperidine-1-carboxylate (PubChem CID 10594689) has the molecular formula C20H28N2O4
and a molecular weight of 360.45 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2R,3S)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-[(2R,3S)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]piperidine-1-carboxylate |
| PubChem CID | 10594689 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | tert-butyl (2S)-2-[(2R,3S)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1[C@@H]1[C@H](O)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H28N2O4/c1-20(2,3)26-19(25)21-12-8-7-11-15(21)16-17(23)18(24)22(16)13-14-9-5-4-6-10-14/h4-6,9-10,15-17,23H,7-8,11-13H2,1-3H3/t15-,16+,17-/m0/s1 |
| InChIKey | YYZBLMLIVGKHMJ-BBWFWOEESA-N |
| XLogP | 2.55 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (2S)-2-[(2R,3S)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-[(2R,3S)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl (2S)-2-[(2R,3S)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]piperidine-1-carboxylate (CID 10594689) is tert-butyl (2S)-2-[(2R,3S)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S)-2-[(2R,3S)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S)-2-[(2R,3S)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCCC[C@H]1[C@@H]1[C@H](O)C(=O)N1Cc1ccccc1.
What is the InChIKey of tert-butyl (2S)-2-[(2R,3S)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]piperidine-1-carboxylate?
The InChIKey is YYZBLMLIVGKHMJ-BBWFWOEESA-N. The full InChI is InChI=1S/C20H28N2O4/c1-20(2,3)26-19(25)21-12-8-7-11-15(21)16-17(23)18(24)22(16)13-14-9-5-4-6-10-14/h4-6,9-10,15-17,23H,7-8,11-13H2,1-3H3/t15-,16+,17-/m0/s1.
What are the key properties of tert-butyl (2S)-2-[(2R,3S)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]piperidine-1-carboxylate?
tert-butyl (2S)-2-[(2R,3S)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]piperidine-1-carboxylate has a molecular weight of 360.45 g/mol, XLogP of 2.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-[(2R,3S)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]piperidine-1-carboxylate is sourced from PubChem (CID 10594689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).