About 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-(cyclopropylmethylsulfonyl)ethanone
1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-(cyclopropylmethylsulfonyl)ethanone (PubChem CID 10594959) has the molecular formula C20H28O4S
and a molecular weight of 364.51 g/mol. Its IUPAC name is 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-(cyclopropylmethylsulfonyl)ethanone.
Molecular Properties
| Compound Name | 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-(cyclopropylmethylsulfonyl)ethanone |
| PubChem CID | 10594959 |
| Molecular Formula | C20H28O4S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-(cyclopropylmethylsulfonyl)ethanone |
| SMILES | CC(C)(C)c1cc(C(=O)CS(=O)(=O)CC2CC2)cc2c1OCC2(C)C |
| InChI | InChI=1S/C20H28O4S/c1-19(2,3)15-8-14(9-16-18(15)24-12-20(16,4)5)17(21)11-25(22,23)10-13-6-7-13/h8-9,13H,6-7,10-12H2,1-5H3 |
| InChIKey | VFJATJUXSGULNB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-(cyclopropylmethylsulfonyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-(cyclopropylmethylsulfonyl)ethanone?
The IUPAC name of 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-(cyclopropylmethylsulfonyl)ethanone (CID 10594959) is 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-(cyclopropylmethylsulfonyl)ethanone.
What is the SMILES notation for 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-(cyclopropylmethylsulfonyl)ethanone?
The canonical SMILES for 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-(cyclopropylmethylsulfonyl)ethanone is CC(C)(C)c1cc(C(=O)CS(=O)(=O)CC2CC2)cc2c1OCC2(C)C.
What is the InChIKey of 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-(cyclopropylmethylsulfonyl)ethanone?
The InChIKey is VFJATJUXSGULNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28O4S/c1-19(2,3)15-8-14(9-16-18(15)24-12-20(16,4)5)17(21)11-25(22,23)10-13-6-7-13/h8-9,13H,6-7,10-12H2,1-5H3.
What are the key properties of 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-(cyclopropylmethylsulfonyl)ethanone?
1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-(cyclopropylmethylsulfonyl)ethanone has a molecular weight of 364.51 g/mol, XLogP of 3.66, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-(cyclopropylmethylsulfonyl)ethanone is sourced from PubChem (CID 10594959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).