C20H36O4Si — CID 10595242
[(4S,6R,9R)-4-[(2S)-but-3-en-2-yl]-2,2-dimethyl-1,3,7-trioxaspiro[5.5]undec-10-en-9-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10595242) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is [(4S,6R,9R)-4-[(2S)-but-3-en-2-yl]-2,2-dimethyl-1,3,7-trioxaspiro[5.5]undec-10-en-9-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4S,6R,9R)-4-[(2S)-but-3-en-2-yl]-2,2-dimethyl-1,3,7-trioxaspiro[5.5]undec-10-en-9-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10595242 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | [(4S,6R,9R)-4-[(2S)-but-3-en-2-yl]-2,2-dimethyl-1,3,7-trioxaspiro[5.5]undec-10-en-9-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@H](C)[C@@H]1C[C@]2(C=C[C@@H](O[Si](C)(C)C(C)(C)C)CO2)OC(C)(C)O1 |
| InChI | InChI=1S/C20H36O4Si/c1-10-15(2)17-13-20(24-19(6,7)22-17)12-11-16(14-21-20)23-25(8,9)18(3,4)5/h10-12,15-17H,1,13-14H2,2-9H3/t15-,16+,17-,20-/m0/s1 |
| InChIKey | FNSUTPYTKBIZJP-CLWJZODNSA-N |
| XLogP | 5.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|