C23H31NO3 — CID 10595288
(Z)-7-[(1R,2R,3S,5S)-2-benzamido-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid (PubChem CID 10595288) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S,5S)-2-benzamido-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S,5S)-2-benzamido-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 10595288 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (Z)-7-[(1R,2R,3S,5S)-2-benzamido-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
| SMILES | CC1(C)[C@H]2C[C@H](C/C=C\CCCC(=O)O)[C@@H](NC(=O)c3ccccc3)[C@@H]1C2 |
| InChI | InChI=1S/C23H31NO3/c1-23(2)18-14-17(12-6-3-4-9-13-20(25)26)21(19(23)15-18)24-22(27)16-10-7-5-8-11-16/h3,5-8,10-11,17-19,21H,4,9,12-15H2,1-2H3,(H,24,27)(H,25,26)/b6-3-/t17-,18-,19-,21+/m0/s1 |
| InChIKey | MIWWWWRKAQVMDU-YKEBRPLOSA-N |
| XLogP | 4.67 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|