C20H39N3O3 — CID 10595293
N,N-bis(2-methyl-4-morpholin-4-ylbutyl)acetamide (PubChem CID 10595293) has the molecular formula C20H39N3O3 and a molecular weight of 369.55 g/mol. Its IUPAC name is N,N-bis(2-methyl-4-morpholin-4-ylbutyl)acetamide.
| Compound Name | N,N-bis(2-methyl-4-morpholin-4-ylbutyl)acetamide |
|---|---|
| PubChem CID | 10595293 |
| Molecular Formula | C20H39N3O3 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.30 |
| IUPAC Name | N,N-bis(2-methyl-4-morpholin-4-ylbutyl)acetamide |
| SMILES | CC(=O)N(CC(C)CCN1CCOCC1)CC(C)CCN1CCOCC1 |
| InChI | InChI=1S/C20H39N3O3/c1-18(4-6-21-8-12-25-13-9-21)16-23(20(3)24)17-19(2)5-7-22-10-14-26-15-11-22/h18-19H,4-17H2,1-3H3 |
| InChIKey | ZTQBHXWZHIBVRV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |