About 1-(benzenesulfonyl)phenoxathiine 10,10-dioxide
1-(benzenesulfonyl)phenoxathiine 10,10-dioxide (PubChem CID 10595448) has the molecular formula C18H12O5S2
and a molecular weight of 372.42 g/mol. Its IUPAC name is 1-(benzenesulfonyl)phenoxathiine 10,10-dioxide.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)phenoxathiine 10,10-dioxide |
| PubChem CID | 10595448 |
| Molecular Formula | C18H12O5S2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 1-(benzenesulfonyl)phenoxathiine 10,10-dioxide |
| SMILES | O=S(=O)(c1ccccc1)c1cccc2c1S(=O)(=O)c1ccccc1O2 |
| InChI | InChI=1S/C18H12O5S2/c19-24(20,13-7-2-1-3-8-13)17-12-6-10-15-18(17)25(21,22)16-11-5-4-9-14(16)23-15/h1-12H |
| InChIKey | AYVTUPJFEOCTHS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(benzenesulfonyl)phenoxathiine 10,10-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)phenoxathiine 10,10-dioxide?
The IUPAC name of 1-(benzenesulfonyl)phenoxathiine 10,10-dioxide (CID 10595448) is 1-(benzenesulfonyl)phenoxathiine 10,10-dioxide.
What is the SMILES notation for 1-(benzenesulfonyl)phenoxathiine 10,10-dioxide?
The canonical SMILES for 1-(benzenesulfonyl)phenoxathiine 10,10-dioxide is O=S(=O)(c1ccccc1)c1cccc2c1S(=O)(=O)c1ccccc1O2.
What is the InChIKey of 1-(benzenesulfonyl)phenoxathiine 10,10-dioxide?
The InChIKey is AYVTUPJFEOCTHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O5S2/c19-24(20,13-7-2-1-3-8-13)17-12-6-10-15-18(17)25(21,22)16-11-5-4-9-14(16)23-15/h1-12H.
What are the key properties of 1-(benzenesulfonyl)phenoxathiine 10,10-dioxide?
1-(benzenesulfonyl)phenoxathiine 10,10-dioxide has a molecular weight of 372.42 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)phenoxathiine 10,10-dioxide is sourced from PubChem (CID 10595448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).