About 1-(3,4-dimethylphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene
1-(3,4-dimethylphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene (PubChem CID 10595453) has the molecular formula C21H18F2O2S
and a molecular weight of 372.44 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene.
Molecular Properties
| Compound Name | 1-(3,4-dimethylphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene |
| PubChem CID | 10595453 |
| Molecular Formula | C21H18F2O2S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene |
| SMILES | Cc1ccc(-c2cc(F)c(F)cc2-c2ccc(S(C)(=O)=O)cc2)cc1C |
| InChI | InChI=1S/C21H18F2O2S/c1-13-4-5-16(10-14(13)2)19-12-21(23)20(22)11-18(19)15-6-8-17(9-7-15)26(3,24)25/h4-12H,1-3H3 |
| InChIKey | XUKVJQAMNLZRMM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,4-dimethylphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethylphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene?
The IUPAC name of 1-(3,4-dimethylphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene (CID 10595453) is 1-(3,4-dimethylphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene.
What is the SMILES notation for 1-(3,4-dimethylphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene?
The canonical SMILES for 1-(3,4-dimethylphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene is Cc1ccc(-c2cc(F)c(F)cc2-c2ccc(S(C)(=O)=O)cc2)cc1C.
What is the InChIKey of 1-(3,4-dimethylphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene?
The InChIKey is XUKVJQAMNLZRMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F2O2S/c1-13-4-5-16(10-14(13)2)19-12-21(23)20(22)11-18(19)15-6-8-17(9-7-15)26(3,24)25/h4-12H,1-3H3.
What are the key properties of 1-(3,4-dimethylphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene?
1-(3,4-dimethylphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene has a molecular weight of 372.44 g/mol, XLogP of 5.32, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethylphenyl)-4,5-difluoro-2-(4-methylsulfonylphenyl)benzene is sourced from PubChem (CID 10595453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).