C17H11ClN2O2S2 — CID 10595606
5-[3-(4-chlorophenyl)prop-2-ynyl]-5-pyridin-2-ylsulfanyl-1,3-thiazolidine-2,4-dione (PubChem CID 10595606) has the molecular formula C17H11ClN2O2S2 and a molecular weight of 374.87 g/mol. Its IUPAC name is 5-[3-(4-chlorophenyl)prop-2-ynyl]-5-pyridin-2-ylsulfanyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[3-(4-chlorophenyl)prop-2-ynyl]-5-pyridin-2-ylsulfanyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10595606 |
| Molecular Formula | C17H11ClN2O2S2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 5-[3-(4-chlorophenyl)prop-2-ynyl]-5-pyridin-2-ylsulfanyl-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CC#Cc2ccc(Cl)cc2)(Sc2ccccn2)S1 |
| InChI | InChI=1S/C17H11ClN2O2S2/c18-13-8-6-12(7-9-13)4-3-10-17(15(21)20-16(22)24-17)23-14-5-1-2-11-19-14/h1-2,5-9,11H,10H2,(H,20,21,22) |
| InChIKey | XFPZFILCXZOTJA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|