C22H38O3Si — CID 10595844
[(3aR,6R,7aR)-6-methyl-6-prop-2-enylspiro[7,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10595844) has the molecular formula C22H38O3Si and a molecular weight of 378.63 g/mol. Its IUPAC name is [(3aR,6R,7aR)-6-methyl-6-prop-2-enylspiro[7,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,6R,7aR)-6-methyl-6-prop-2-enylspiro[7,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10595844 |
| Molecular Formula | C22H38O3Si |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | [(3aR,6R,7aR)-6-methyl-6-prop-2-enylspiro[7,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CC[C@@]1(C)C=C(O[Si](C)(C)C(C)(C)C)[C@@H]2OC3(CCCCC3)O[C@@H]2C1 |
| InChI | InChI=1S/C22H38O3Si/c1-8-12-21(5)15-17-19(24-22(23-17)13-10-9-11-14-22)18(16-21)25-26(6,7)20(2,3)4/h8,16-17,19H,1,9-15H2,2-7H3/t17-,19-,21-/m1/s1 |
| InChIKey | UEHLYHXKJPWEGQ-YFVAEKQCSA-N |
| XLogP | 6.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|