C5H6Br3F3O — CID 10595847
2,2,3-tribromo-3-ethoxy-1,1,1-trifluoropropane (PubChem CID 10595847) has the molecular formula C5H6Br3F3O and a molecular weight of 378.81 g/mol. Its IUPAC name is 2,2,3-tribromo-3-ethoxy-1,1,1-trifluoropropane.
| Compound Name | 2,2,3-tribromo-3-ethoxy-1,1,1-trifluoropropane |
|---|---|
| PubChem CID | 10595847 |
| Molecular Formula | C5H6Br3F3O |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 375.79 |
| IUPAC Name | 2,2,3-tribromo-3-ethoxy-1,1,1-trifluoropropane |
| SMILES | CCOC(Br)C(Br)(Br)C(F)(F)F |
| InChI | InChI=1S/C5H6Br3F3O/c1-2-12-3(6)4(7,8)5(9,10)11/h3H,2H2,1H3 |
| InChIKey | CSPIEWMVIYLTKD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|