C19H30FN5O2 — CID 10595892
6-(diaminomethylideneamino)-N-[4-[[2-(4-fluorophenyl)acetyl]amino]butyl]hexanamide (PubChem CID 10595892) has the molecular formula C19H30FN5O2 and a molecular weight of 379.48 g/mol. Its IUPAC name is 6-(diaminomethylideneamino)-N-[4-[[2-(4-fluorophenyl)acetyl]amino]butyl]hexanamide.
| Compound Name | 6-(diaminomethylideneamino)-N-[4-[[2-(4-fluorophenyl)acetyl]amino]butyl]hexanamide |
|---|---|
| PubChem CID | 10595892 |
| Molecular Formula | C19H30FN5O2 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 6-(diaminomethylideneamino)-N-[4-[[2-(4-fluorophenyl)acetyl]amino]butyl]hexanamide |
| SMILES | NC(N)=NCCCCCC(=O)NCCCCNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H30FN5O2/c20-16-9-7-15(8-10-16)14-18(27)24-12-5-4-11-23-17(26)6-2-1-3-13-25-19(21)22/h7-10H,1-6,11-14H2,(H,23,26)(H,24,27)(H4,21,22,25) |
| InChIKey | SSNBZNZRPNNFRJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|