C20H33NO4Si — CID 10595904
(4aS,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2,7-trimethyl-4-oxo-8,8a-dihydro-3H-chromene-4a-carbonitrile (PubChem CID 10595904) has the molecular formula C20H33NO4Si and a molecular weight of 379.57 g/mol. Its IUPAC name is (4aS,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2,7-trimethyl-4-oxo-8,8a-dihydro-3H-chromene-4a-carbonitrile.
| Compound Name | (4aS,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2,7-trimethyl-4-oxo-8,8a-dihydro-3H-chromene-4a-carbonitrile |
|---|---|
| PubChem CID | 10595904 |
| Molecular Formula | C20H33NO4Si |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | (4aS,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2,7-trimethyl-4-oxo-8,8a-dihydro-3H-chromene-4a-carbonitrile |
| SMILES | COC1(O[Si](C)(C)C(C)(C)C)C=C(C)C[C@H]2OC(C)(C)CC(=O)[C@]21C#N |
| InChI | InChI=1S/C20H33NO4Si/c1-14-10-16-19(13-21,15(22)12-18(5,6)24-16)20(11-14,23-7)25-26(8,9)17(2,3)4/h11,16H,10,12H2,1-9H3/t16-,19-,20?/m1/s1 |
| InChIKey | JDFDFKMQAHMHLN-YPMWCJOZSA-N |
| XLogP | 4.35 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|