C23H44O2Si — CID 10595971
(2E,4R,5R,6E,8S)-2,4,6,8-tetramethyl-5-tri(propan-2-yl)silyloxydeca-2,6-dienal (PubChem CID 10595971) has the molecular formula C23H44O2Si and a molecular weight of 380.69 g/mol. Its IUPAC name is (2E,4R,5R,6E,8S)-2,4,6,8-tetramethyl-5-tri(propan-2-yl)silyloxydeca-2,6-dienal.
| Compound Name | (2E,4R,5R,6E,8S)-2,4,6,8-tetramethyl-5-tri(propan-2-yl)silyloxydeca-2,6-dienal |
|---|---|
| PubChem CID | 10595971 |
| Molecular Formula | C23H44O2Si |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | (2E,4R,5R,6E,8S)-2,4,6,8-tetramethyl-5-tri(propan-2-yl)silyloxydeca-2,6-dienal |
| SMILES | CC[C@H](C)/C=C(\C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)/C=C(\C)C=O |
| InChI | InChI=1S/C23H44O2Si/c1-12-19(8)13-21(10)23(22(11)14-20(9)15-24)25-26(16(2)3,17(4)5)18(6)7/h13-19,22-23H,12H2,1-11H3/b20-14+,21-13+/t19-,22+,23-/m0/s1 |
| InChIKey | BUCALXGHWFZBTJ-HHBASZSOSA-N |
| XLogP | 7.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|