C18H17F3N4 — CID 10596106
2-methyl-4-piperidin-1-yl-6-(3,4,5-trifluorophenyl)-5H-pyrrolo[3,2-d]pyrimidine (PubChem CID 10596106) has the molecular formula C18H17F3N4 and a molecular weight of 346.36 g/mol. Its IUPAC name is 2-methyl-4-piperidin-1-yl-6-(3,4,5-trifluorophenyl)-5H-pyrrolo[3,2-d]pyrimidine.
| Compound Name | 2-methyl-4-piperidin-1-yl-6-(3,4,5-trifluorophenyl)-5H-pyrrolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 10596106 |
| Molecular Formula | C18H17F3N4 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-methyl-4-piperidin-1-yl-6-(3,4,5-trifluorophenyl)-5H-pyrrolo[3,2-d]pyrimidine |
| SMILES | Cc1nc(N2CCCCC2)c2[nH]c(-c3cc(F)c(F)c(F)c3)cc2n1 |
| InChI | InChI=1S/C18H17F3N4/c1-10-22-15-9-14(11-7-12(19)16(21)13(20)8-11)24-17(15)18(23-10)25-5-3-2-4-6-25/h7-9,24H,2-6H2,1H3 |
| InChIKey | KRWJCKHWSFDPIW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|