C18H15F4NO2S — CID 10596233
4-[2-[3-fluoro-4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide (PubChem CID 10596233) has the molecular formula C18H15F4NO2S and a molecular weight of 385.38 g/mol. Its IUPAC name is 4-[2-[3-fluoro-4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide.
| Compound Name | 4-[2-[3-fluoro-4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10596233 |
| Molecular Formula | C18H15F4NO2S |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 4-[2-[3-fluoro-4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2=C(c3ccc(C(F)(F)F)c(F)c3)CCC2)cc1 |
| InChI | InChI=1S/C18H15F4NO2S/c19-17-10-12(6-9-16(17)18(20,21)22)15-3-1-2-14(15)11-4-7-13(8-5-11)26(23,24)25/h4-10H,1-3H2,(H2,23,24,25) |
| InChIKey | LVXZYVWYUMVRQY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|