About CID 10596345
CID 10596345 (PubChem CID 10596345) has the molecular formula C18H21FeNO5+2
and a molecular weight of 387.21 g/mol.
Molecular Properties
| Compound Name | CID 10596345 |
| PubChem CID | 10596345 |
| Molecular Formula | C18H21FeNO5+2 |
| Molecular Weight | 387.21 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@@H]1[C@@H]([C]2[CH][CH][CH][CH]2)N(C)O[C@H]1C(=O)OC.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C13H16NO5.C5H5.Fe/c1-14-10(8-6-4-5-7-8)9(12(15)17-2)11(19-14)13(16)18-3;1-2-4-5-3-1;/h4-7,9-11H,1-3H3;1-5H;/q;;+2/t9-,10-,11-;;/m1../s1 |
| InChIKey | VPRLCNFNKSCHOR-JTSZZRRXSA-N |
| XLogP | 0.99 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 10596345 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10596345?
The IUPAC name of CID 10596345 (CID 10596345) is not available.
What is the SMILES notation for CID 10596345?
The canonical SMILES for CID 10596345 is COC(=O)[C@@H]1[C@@H]([C]2[CH][CH][CH][CH]2)N(C)O[C@H]1C(=O)OC.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 10596345?
The InChIKey is VPRLCNFNKSCHOR-JTSZZRRXSA-N. The full InChI is InChI=1S/C13H16NO5.C5H5.Fe/c1-14-10(8-6-4-5-7-8)9(12(15)17-2)11(19-14)13(16)18-3;1-2-4-5-3-1;/h4-7,9-11H,1-3H3;1-5H;/q;;+2/t9-,10-,11-;;/m1../s1.
What are the key properties of CID 10596345?
CID 10596345 has a molecular weight of 387.21 g/mol, XLogP of 0.99, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10596345 is sourced from PubChem (CID 10596345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).