C19H12F7N — CID 10596354
2-(1,1,2,2,3,3,3-heptafluoropropyl)-3,5-diphenyl-1H-pyrrole (PubChem CID 10596354) has the molecular formula C19H12F7N and a molecular weight of 387.30 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3,5-diphenyl-1H-pyrrole.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3,5-diphenyl-1H-pyrrole |
|---|---|
| PubChem CID | 10596354 |
| Molecular Formula | C19H12F7N |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3,5-diphenyl-1H-pyrrole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)c1[nH]c(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C19H12F7N/c20-17(21,18(22,23)19(24,25)26)16-14(12-7-3-1-4-8-12)11-15(27-16)13-9-5-2-6-10-13/h1-11,27H |
| InChIKey | PVQCSKWOMMUXIK-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|