About [6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-8-yl] methanesulfonate
[6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-8-yl] methanesulfonate (PubChem CID 10596380) has the molecular formula C19H21N3O4S
and a molecular weight of 387.46 g/mol. Its IUPAC name is [6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-8-yl] methanesulfonate.
Molecular Properties
| Compound Name | [6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-8-yl] methanesulfonate |
| PubChem CID | 10596380 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | [6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-8-yl] methanesulfonate |
| SMILES | CN1CCN(C2=Nc3ccccc3Oc3ccc(OS(C)(=O)=O)cc32)CC1 |
| InChI | InChI=1S/C19H21N3O4S/c1-21-9-11-22(12-10-21)19-15-13-14(26-27(2,23)24)7-8-17(15)25-18-6-4-3-5-16(18)20-19/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | LUZGPEPGAGXEQF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-8-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-8-yl] methanesulfonate?
The IUPAC name of [6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-8-yl] methanesulfonate (CID 10596380) is [6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-8-yl] methanesulfonate.
What is the SMILES notation for [6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-8-yl] methanesulfonate?
The canonical SMILES for [6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-8-yl] methanesulfonate is CN1CCN(C2=Nc3ccccc3Oc3ccc(OS(C)(=O)=O)cc32)CC1.
What is the InChIKey of [6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-8-yl] methanesulfonate?
The InChIKey is LUZGPEPGAGXEQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O4S/c1-21-9-11-22(12-10-21)19-15-13-14(26-27(2,23)24)7-8-17(15)25-18-6-4-3-5-16(18)20-19/h3-8,13H,9-12H2,1-2H3.
What are the key properties of [6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-8-yl] methanesulfonate?
[6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-8-yl] methanesulfonate has a molecular weight of 387.46 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepin-8-yl] methanesulfonate is sourced from PubChem (CID 10596380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).