C10H16N8OS4 — CID 10596703
13-oxa-2,5,10,16-tetrathia-7,8,18,19,20,21-hexazatricyclo[15.2.1.16,9]henicosa-1(19),6,8,17-tetraene-20,21-diamine (PubChem CID 10596703) has the molecular formula C10H16N8OS4 and a molecular weight of 392.56 g/mol. Its IUPAC name is 13-oxa-2,5,10,16-tetrathia-7,8,18,19,20,21-hexazatricyclo[15.2.1.16,9]henicosa-1(19),6,8,17-tetraene-20,21-diamine.
| Compound Name | 13-oxa-2,5,10,16-tetrathia-7,8,18,19,20,21-hexazatricyclo[15.2.1.16,9]henicosa-1(19),6,8,17-tetraene-20,21-diamine |
|---|---|
| PubChem CID | 10596703 |
| Molecular Formula | C10H16N8OS4 |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 13-oxa-2,5,10,16-tetrathia-7,8,18,19,20,21-hexazatricyclo[15.2.1.16,9]henicosa-1(19),6,8,17-tetraene-20,21-diamine |
| SMILES | Nn1c2nnc1SCCSc1nnc(n1N)SCCOCCS2 |
| InChI | InChI=1S/C10H16N8OS4/c11-17-7-13-15-9(17)22-5-6-23-10-16-14-8(18(10)12)21-4-2-19-1-3-20-7/h1-6,11-12H2 |
| InChIKey | UQLPYPDPMXNWLS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 122.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |