C24H44O2Si — CID 10596712
(1R,4aR,4bS,7R,8aS,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,4b,8,8-tetramethyl-2,4,4a,5,6,7,8a,9,10,10a-decahydro-1H-phenanthren-3-one (PubChem CID 10596712) has the molecular formula C24H44O2Si and a molecular weight of 392.70 g/mol. Its IUPAC name is (1R,4aR,4bS,7R,8aS,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,4b,8,8-tetramethyl-2,4,4a,5,6,7,8a,9,10,10a-decahydro-1H-phenanthren-3-one.
| Compound Name | (1R,4aR,4bS,7R,8aS,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,4b,8,8-tetramethyl-2,4,4a,5,6,7,8a,9,10,10a-decahydro-1H-phenanthren-3-one |
|---|---|
| PubChem CID | 10596712 |
| Molecular Formula | C24H44O2Si |
| Molecular Weight | 392.70 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | (1R,4aR,4bS,7R,8aS,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,4b,8,8-tetramethyl-2,4,4a,5,6,7,8a,9,10,10a-decahydro-1H-phenanthren-3-one |
| SMILES | C[C@@H]1CC(=O)C[C@@H]2[C@@H]1CC[C@@H]1C(C)(C)[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@]21C |
| InChI | InChI=1S/C24H44O2Si/c1-16-14-17(25)15-19-18(16)10-11-20-23(5,6)21(12-13-24(19,20)7)26-27(8,9)22(2,3)4/h16,18-21H,10-15H2,1-9H3/t16-,18-,19-,20-,21-,24+/m1/s1 |
| InChIKey | YWKMGMSNSHZVEP-WRMJGRORSA-N |
| XLogP | 6.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.70 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|