C17H18N2O9 — CID 10596778
dimethyl (8R,9S)-8,9-dihydroxy-4-methoxycarbonyloxy-3,7,8,9-tetrahydropyrrolo[3,2-f]quinoline-2,6-dicarboxylate (PubChem CID 10596778) has the molecular formula C17H18N2O9 and a molecular weight of 394.34 g/mol. Its IUPAC name is dimethyl (8R,9S)-8,9-dihydroxy-4-methoxycarbonyloxy-3,7,8,9-tetrahydropyrrolo[3,2-f]quinoline-2,6-dicarboxylate.
| Compound Name | dimethyl (8R,9S)-8,9-dihydroxy-4-methoxycarbonyloxy-3,7,8,9-tetrahydropyrrolo[3,2-f]quinoline-2,6-dicarboxylate |
|---|---|
| PubChem CID | 10596778 |
| Molecular Formula | C17H18N2O9 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | dimethyl (8R,9S)-8,9-dihydroxy-4-methoxycarbonyloxy-3,7,8,9-tetrahydropyrrolo[3,2-f]quinoline-2,6-dicarboxylate |
| SMILES | COC(=O)Oc1cc2c(c3cc(C(=O)OC)[nH]c13)[C@H](O)[C@H](O)CN2C(=O)OC |
| InChI | InChI=1S/C17H18N2O9/c1-25-15(22)8-4-7-12-9(5-11(13(7)18-8)28-17(24)27-3)19(16(23)26-2)6-10(20)14(12)21/h4-5,10,14,18,20-21H,6H2,1-3H3/t10-,14-/m1/s1 |
| InChIKey | FKTBIMISPGVERQ-QMTHXVAHSA-N |
| XLogP | 1.08 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|