C22H26O7 — CID 10597224
3-(2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl)propanoic acid (PubChem CID 10597224) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is 3-(2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl)propanoic acid.
| Compound Name | 3-(2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl)propanoic acid |
|---|---|
| PubChem CID | 10597224 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-(2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl)propanoic acid |
| SMILES | O=C(O)CCC1COc2ccccc2OCCOCCOc2ccccc2OC1 |
| InChI | InChI=1S/C22H26O7/c23-22(24)10-9-17-15-28-20-7-3-1-5-18(20)26-13-11-25-12-14-27-19-6-2-4-8-21(19)29-16-17/h1-8,17H,9-16H2,(H,23,24) |
| InChIKey | ZUPVXMXSLGLIGR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |