C24H16F3NS — CID 10597519
4,4-diphenyl-8-(trifluoromethyl)pyrrolo[2,1-c][1,4]benzothiazine (PubChem CID 10597519) has the molecular formula C24H16F3NS and a molecular weight of 407.46 g/mol. Its IUPAC name is 4,4-diphenyl-8-(trifluoromethyl)pyrrolo[2,1-c][1,4]benzothiazine.
| Compound Name | 4,4-diphenyl-8-(trifluoromethyl)pyrrolo[2,1-c][1,4]benzothiazine |
|---|---|
| PubChem CID | 10597519 |
| Molecular Formula | C24H16F3NS |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 4,4-diphenyl-8-(trifluoromethyl)pyrrolo[2,1-c][1,4]benzothiazine |
| SMILES | FC(F)(F)c1ccc2c(c1)-n1cccc1C(c1ccccc1)(c1ccccc1)S2 |
| InChI | InChI=1S/C24H16F3NS/c25-24(26,27)19-13-14-21-20(16-19)28-15-7-12-22(28)23(29-21,17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-16H |
| InChIKey | LUNBJPOQNBTMJW-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |