About CID 10597593
CID 10597593 (PubChem CID 10597593) has the molecular formula C23H36O6
and a molecular weight of 408.54 g/mol.
Molecular Properties
| Compound Name | CID 10597593 |
| PubChem CID | 10597593 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | — |
| SMILES | CO[C@H]1OC(=O)C[C@]12CC[C@@]1(O2)[C@H](C)C[C@@H](OC(C)=O)[C@H]2C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C23H36O6/c1-14-12-16(27-15(2)24)18-20(3,4)8-7-9-21(18,5)23(14)11-10-22(29-23)13-17(25)28-19(22)26-6/h14,16,18-19H,7-13H2,1-6H3/t14-,16-,18+,19+,21+,22-,23-/m1/s1 |
| InChIKey | SFOHMBBFSBTGGN-TUBJXHARSA-N |
| XLogP | 4.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 10597593 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10597593?
The IUPAC name of CID 10597593 (CID 10597593) is not available.
What is the SMILES notation for CID 10597593?
The canonical SMILES for CID 10597593 is CO[C@H]1OC(=O)C[C@]12CC[C@@]1(O2)[C@H](C)C[C@@H](OC(C)=O)[C@H]2C(C)(C)CCC[C@@]21C.
What is the InChIKey of CID 10597593?
The InChIKey is SFOHMBBFSBTGGN-TUBJXHARSA-N. The full InChI is InChI=1S/C23H36O6/c1-14-12-16(27-15(2)24)18-20(3,4)8-7-9-21(18,5)23(14)11-10-22(29-23)13-17(25)28-19(22)26-6/h14,16,18-19H,7-13H2,1-6H3/t14-,16-,18+,19+,21+,22-,23-/m1/s1.
What are the key properties of CID 10597593?
CID 10597593 has a molecular weight of 408.54 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10597593 is sourced from PubChem (CID 10597593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).