About trimethylsilyl 4-[(2S,3S)-3-acetyloxy-2-(4-methylphenyl)-4-oxoazetidin-1-yl]benzoate
trimethylsilyl 4-[(2S,3S)-3-acetyloxy-2-(4-methylphenyl)-4-oxoazetidin-1-yl]benzoate (PubChem CID 10597745) has the molecular formula C22H25NO5Si
and a molecular weight of 411.53 g/mol. Its IUPAC name is trimethylsilyl 4-[(2S,3S)-3-acetyloxy-2-(4-methylphenyl)-4-oxoazetidin-1-yl]benzoate.
Molecular Properties
| Compound Name | trimethylsilyl 4-[(2S,3S)-3-acetyloxy-2-(4-methylphenyl)-4-oxoazetidin-1-yl]benzoate |
| PubChem CID | 10597745 |
| Molecular Formula | C22H25NO5Si |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | trimethylsilyl 4-[(2S,3S)-3-acetyloxy-2-(4-methylphenyl)-4-oxoazetidin-1-yl]benzoate |
| SMILES | CC(=O)O[C@@H]1C(=O)N(c2ccc(C(=O)O[Si](C)(C)C)cc2)[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C22H25NO5Si/c1-14-6-8-16(9-7-14)19-20(27-15(2)24)21(25)23(19)18-12-10-17(11-13-18)22(26)28-29(3,4)5/h6-13,19-20H,1-5H3/t19-,20-/m0/s1 |
| InChIKey | UMMPPESUJPUREO-PMACEKPBSA-N |
| XLogP | 4.01 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl 4-[(2S,3S)-3-acetyloxy-2-(4-methylphenyl)-4-oxoazetidin-1-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl 4-[(2S,3S)-3-acetyloxy-2-(4-methylphenyl)-4-oxoazetidin-1-yl]benzoate?
The IUPAC name of trimethylsilyl 4-[(2S,3S)-3-acetyloxy-2-(4-methylphenyl)-4-oxoazetidin-1-yl]benzoate (CID 10597745) is trimethylsilyl 4-[(2S,3S)-3-acetyloxy-2-(4-methylphenyl)-4-oxoazetidin-1-yl]benzoate.
What is the SMILES notation for trimethylsilyl 4-[(2S,3S)-3-acetyloxy-2-(4-methylphenyl)-4-oxoazetidin-1-yl]benzoate?
The canonical SMILES for trimethylsilyl 4-[(2S,3S)-3-acetyloxy-2-(4-methylphenyl)-4-oxoazetidin-1-yl]benzoate is CC(=O)O[C@@H]1C(=O)N(c2ccc(C(=O)O[Si](C)(C)C)cc2)[C@H]1c1ccc(C)cc1.
What is the InChIKey of trimethylsilyl 4-[(2S,3S)-3-acetyloxy-2-(4-methylphenyl)-4-oxoazetidin-1-yl]benzoate?
The InChIKey is UMMPPESUJPUREO-PMACEKPBSA-N. The full InChI is InChI=1S/C22H25NO5Si/c1-14-6-8-16(9-7-14)19-20(27-15(2)24)21(25)23(19)18-12-10-17(11-13-18)22(26)28-29(3,4)5/h6-13,19-20H,1-5H3/t19-,20-/m0/s1.
What are the key properties of trimethylsilyl 4-[(2S,3S)-3-acetyloxy-2-(4-methylphenyl)-4-oxoazetidin-1-yl]benzoate?
trimethylsilyl 4-[(2S,3S)-3-acetyloxy-2-(4-methylphenyl)-4-oxoazetidin-1-yl]benzoate has a molecular weight of 411.53 g/mol, XLogP of 4.01, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 4-[(2S,3S)-3-acetyloxy-2-(4-methylphenyl)-4-oxoazetidin-1-yl]benzoate is sourced from PubChem (CID 10597745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).