C24H28O6 — CID 10597779
ethyl (E)-3-(5-hydroxy-2,3,8,8-tetramethyl-4-oxopyrano[2,3-h]chromen-6-yl)hex-2-enoate (PubChem CID 10597779) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is ethyl (E)-3-(5-hydroxy-2,3,8,8-tetramethyl-4-oxopyrano[2,3-h]chromen-6-yl)hex-2-enoate.
| Compound Name | ethyl (E)-3-(5-hydroxy-2,3,8,8-tetramethyl-4-oxopyrano[2,3-h]chromen-6-yl)hex-2-enoate |
|---|---|
| PubChem CID | 10597779 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | ethyl (E)-3-(5-hydroxy-2,3,8,8-tetramethyl-4-oxopyrano[2,3-h]chromen-6-yl)hex-2-enoate |
| SMILES | CCC/C(=C\C(=O)OCC)c1c2c(c3oc(C)c(C)c(=O)c3c1O)C=CC(C)(C)O2 |
| InChI | InChI=1S/C24H28O6/c1-7-9-15(12-17(25)28-8-2)18-21(27)19-20(26)13(3)14(4)29-22(19)16-10-11-24(5,6)30-23(16)18/h10-12,27H,7-9H2,1-6H3/b15-12+ |
| InChIKey | WQADCGFFNUACAM-NTCAYCPXSA-N |
| XLogP | 5.05 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|