C23H22N4O4 — CID 10598109
(3R)-3-[7-[2-(4-carbamimidoylphenyl)ethynyl]-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoic acid (PubChem CID 10598109) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is (3R)-3-[7-[2-(4-carbamimidoylphenyl)ethynyl]-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoic acid.
| Compound Name | (3R)-3-[7-[2-(4-carbamimidoylphenyl)ethynyl]-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 10598109 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (3R)-3-[7-[2-(4-carbamimidoylphenyl)ethynyl]-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C#Cc2ccc3c(c2)C(=O)N([C@H](C)CC(=O)O)CC(=O)N3C)cc1 |
| InChI | InChI=1S/C23H22N4O4/c1-14(11-21(29)30)27-13-20(28)26(2)19-10-7-16(12-18(19)23(27)31)4-3-15-5-8-17(9-6-15)22(24)25/h5-10,12,14H,11,13H2,1-2H3,(H3,24,25)(H,29,30)/t14-/m1/s1 |
| InChIKey | WUDMWSRCKXOKCG-CQSZACIVSA-N |
| XLogP | 1.65 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|