C24H37NO5 — CID 10598182
methyl 2-[2-[(3,5-ditert-butyl-1-methyl-4-oxocyclohexa-2,5-dien-1-yl)methyl]-2-nitrocyclopentyl]acetate (PubChem CID 10598182) has the molecular formula C24H37NO5 and a molecular weight of 419.56 g/mol. Its IUPAC name is methyl 2-[2-[(3,5-ditert-butyl-1-methyl-4-oxocyclohexa-2,5-dien-1-yl)methyl]-2-nitrocyclopentyl]acetate.
| Compound Name | methyl 2-[2-[(3,5-ditert-butyl-1-methyl-4-oxocyclohexa-2,5-dien-1-yl)methyl]-2-nitrocyclopentyl]acetate |
|---|---|
| PubChem CID | 10598182 |
| Molecular Formula | C24H37NO5 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | methyl 2-[2-[(3,5-ditert-butyl-1-methyl-4-oxocyclohexa-2,5-dien-1-yl)methyl]-2-nitrocyclopentyl]acetate |
| SMILES | COC(=O)CC1CCCC1(CC1(C)C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1)[N+](=O)[O-] |
| InChI | InChI=1S/C24H37NO5/c1-21(2,3)17-13-23(7,14-18(20(17)27)22(4,5)6)15-24(25(28)29)11-9-10-16(24)12-19(26)30-8/h13-14,16H,9-12,15H2,1-8H3 |
| InChIKey | KEAKCCMXRKBQRQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|