C24H40O4Si — CID 10598246
(1R,2R,3R,7R,8S)-2-[tert-butyl(dimethyl)silyl]oxy-6,16,16-trimethyl-15-oxatetracyclo[6.6.1.13,7.01,10]hexadeca-5,9-diene-7,8-diol (PubChem CID 10598246) has the molecular formula C24H40O4Si and a molecular weight of 420.67 g/mol. Its IUPAC name is (1R,2R,3R,7R,8S)-2-[tert-butyl(dimethyl)silyl]oxy-6,16,16-trimethyl-15-oxatetracyclo[6.6.1.13,7.01,10]hexadeca-5,9-diene-7,8-diol.
| Compound Name | (1R,2R,3R,7R,8S)-2-[tert-butyl(dimethyl)silyl]oxy-6,16,16-trimethyl-15-oxatetracyclo[6.6.1.13,7.01,10]hexadeca-5,9-diene-7,8-diol |
|---|---|
| PubChem CID | 10598246 |
| Molecular Formula | C24H40O4Si |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | (1R,2R,3R,7R,8S)-2-[tert-butyl(dimethyl)silyl]oxy-6,16,16-trimethyl-15-oxatetracyclo[6.6.1.13,7.01,10]hexadeca-5,9-diene-7,8-diol |
| SMILES | CC1=CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]34CCCCC3=C[C@](O)(O4)[C@]1(O)C2(C)C |
| InChI | InChI=1S/C24H40O4Si/c1-16-12-13-18-19(27-29(7,8)20(2,3)4)22-14-10-9-11-17(22)15-23(25,28-22)24(16,26)21(18,5)6/h12,15,18-19,25-26H,9-11,13-14H2,1-8H3/t18-,19+,22+,23-,24+/m0/s1 |
| InChIKey | SQDXOATXBODJFD-QENKCHOGSA-N |
| XLogP | 5.07 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|