C24H23NO4S — CID 10598279
ethyl (2R,3R,4R)-1-(benzenesulfonyl)-3,4-diphenylazetidine-2-carboxylate (PubChem CID 10598279) has the molecular formula C24H23NO4S and a molecular weight of 421.52 g/mol. Its IUPAC name is ethyl (2R,3R,4R)-1-(benzenesulfonyl)-3,4-diphenylazetidine-2-carboxylate.
| Compound Name | ethyl (2R,3R,4R)-1-(benzenesulfonyl)-3,4-diphenylazetidine-2-carboxylate |
|---|---|
| PubChem CID | 10598279 |
| Molecular Formula | C24H23NO4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | ethyl (2R,3R,4R)-1-(benzenesulfonyl)-3,4-diphenylazetidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](c2ccccc2)[C@H](c2ccccc2)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H23NO4S/c1-2-29-24(26)23-21(18-12-6-3-7-13-18)22(19-14-8-4-9-15-19)25(23)30(27,28)20-16-10-5-11-17-20/h3-17,21-23H,2H2,1H3/t21-,22+,23-/m1/s1 |
| InChIKey | VGBRJIDDSCYFEV-XPWALMASSA-N |
| XLogP | 4.15 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |