C27H35NO3 — CID 10598286
4-[(E)-N-[(2-methylpropan-2-yl)oxy]-C-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]benzoic acid (PubChem CID 10598286) has the molecular formula C27H35NO3 and a molecular weight of 421.58 g/mol. Its IUPAC name is 4-[(E)-N-[(2-methylpropan-2-yl)oxy]-C-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]benzoic acid.
| Compound Name | 4-[(E)-N-[(2-methylpropan-2-yl)oxy]-C-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]benzoic acid |
|---|---|
| PubChem CID | 10598286 |
| Molecular Formula | C27H35NO3 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | 4-[(E)-N-[(2-methylpropan-2-yl)oxy]-C-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]benzoic acid |
| SMILES | Cc1cc2c(cc1/C(=N/OC(C)(C)C)c1ccc(C(=O)O)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C27H35NO3/c1-17-15-21-22(27(7,8)14-13-26(21,5)6)16-20(17)23(28-31-25(2,3)4)18-9-11-19(12-10-18)24(29)30/h9-12,15-16H,13-14H2,1-8H3,(H,29,30)/b28-23+ |
| InChIKey | IRYDQALSBKMVMT-WEMUOSSPSA-N |
| XLogP | 6.61 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|