About methyl (3S)-4-(4-bromophenyl)sulfonyl-2,2-dimethyl-1,4-thiazepane-3-carboxylate
methyl (3S)-4-(4-bromophenyl)sulfonyl-2,2-dimethyl-1,4-thiazepane-3-carboxylate (PubChem CID 10598307) has the molecular formula C15H20BrNO4S2
and a molecular weight of 422.37 g/mol. Its IUPAC name is methyl (3S)-4-(4-bromophenyl)sulfonyl-2,2-dimethyl-1,4-thiazepane-3-carboxylate.
Molecular Properties
| Compound Name | methyl (3S)-4-(4-bromophenyl)sulfonyl-2,2-dimethyl-1,4-thiazepane-3-carboxylate |
| PubChem CID | 10598307 |
| Molecular Formula | C15H20BrNO4S2 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 421.00 |
| IUPAC Name | methyl (3S)-4-(4-bromophenyl)sulfonyl-2,2-dimethyl-1,4-thiazepane-3-carboxylate |
| SMILES | COC(=O)[C@@H]1N(S(=O)(=O)c2ccc(Br)cc2)CCCSC1(C)C |
| InChI | InChI=1S/C15H20BrNO4S2/c1-15(2)13(14(18)21-3)17(9-4-10-22-15)23(19,20)12-7-5-11(16)6-8-12/h5-8,13H,4,9-10H2,1-3H3/t13-/m0/s1 |
| InChIKey | MOHDHNHLRCJQDD-ZDUSSCGKSA-N |
| XLogP | 2.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (3S)-4-(4-bromophenyl)sulfonyl-2,2-dimethyl-1,4-thiazepane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-4-(4-bromophenyl)sulfonyl-2,2-dimethyl-1,4-thiazepane-3-carboxylate?
The IUPAC name of methyl (3S)-4-(4-bromophenyl)sulfonyl-2,2-dimethyl-1,4-thiazepane-3-carboxylate (CID 10598307) is methyl (3S)-4-(4-bromophenyl)sulfonyl-2,2-dimethyl-1,4-thiazepane-3-carboxylate.
What is the SMILES notation for methyl (3S)-4-(4-bromophenyl)sulfonyl-2,2-dimethyl-1,4-thiazepane-3-carboxylate?
The canonical SMILES for methyl (3S)-4-(4-bromophenyl)sulfonyl-2,2-dimethyl-1,4-thiazepane-3-carboxylate is COC(=O)[C@@H]1N(S(=O)(=O)c2ccc(Br)cc2)CCCSC1(C)C.
What is the InChIKey of methyl (3S)-4-(4-bromophenyl)sulfonyl-2,2-dimethyl-1,4-thiazepane-3-carboxylate?
The InChIKey is MOHDHNHLRCJQDD-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H20BrNO4S2/c1-15(2)13(14(18)21-3)17(9-4-10-22-15)23(19,20)12-7-5-11(16)6-8-12/h5-8,13H,4,9-10H2,1-3H3/t13-/m0/s1.
What are the key properties of methyl (3S)-4-(4-bromophenyl)sulfonyl-2,2-dimethyl-1,4-thiazepane-3-carboxylate?
methyl (3S)-4-(4-bromophenyl)sulfonyl-2,2-dimethyl-1,4-thiazepane-3-carboxylate has a molecular weight of 422.37 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-4-(4-bromophenyl)sulfonyl-2,2-dimethyl-1,4-thiazepane-3-carboxylate is sourced from PubChem (CID 10598307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).