About 2-[(E)-1,2-dibromo-2-(4-chlorophenyl)ethenyl]quinoxaline
2-[(E)-1,2-dibromo-2-(4-chlorophenyl)ethenyl]quinoxaline (PubChem CID 10598419) has the molecular formula C16H9Br2ClN2
and a molecular weight of 424.52 g/mol. Its IUPAC name is 2-[(E)-1,2-dibromo-2-(4-chlorophenyl)ethenyl]quinoxaline.
Molecular Properties
| Compound Name | 2-[(E)-1,2-dibromo-2-(4-chlorophenyl)ethenyl]quinoxaline |
| PubChem CID | 10598419 |
| Molecular Formula | C16H9Br2ClN2 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 421.88 |
| IUPAC Name | 2-[(E)-1,2-dibromo-2-(4-chlorophenyl)ethenyl]quinoxaline |
| SMILES | Clc1ccc(/C(Br)=C(\Br)c2cnc3ccccc3n2)cc1 |
| InChI | InChI=1S/C16H9Br2ClN2/c17-15(10-5-7-11(19)8-6-10)16(18)14-9-20-12-3-1-2-4-13(12)21-14/h1-9H/b16-15+ |
| InChIKey | CTUUCQFZGCQWSH-FOCLMDBBSA-N |
| XLogP | 5.90 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(E)-1,2-dibromo-2-(4-chlorophenyl)ethenyl]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-1,2-dibromo-2-(4-chlorophenyl)ethenyl]quinoxaline?
The IUPAC name of 2-[(E)-1,2-dibromo-2-(4-chlorophenyl)ethenyl]quinoxaline (CID 10598419) is 2-[(E)-1,2-dibromo-2-(4-chlorophenyl)ethenyl]quinoxaline.
What is the SMILES notation for 2-[(E)-1,2-dibromo-2-(4-chlorophenyl)ethenyl]quinoxaline?
The canonical SMILES for 2-[(E)-1,2-dibromo-2-(4-chlorophenyl)ethenyl]quinoxaline is Clc1ccc(/C(Br)=C(\Br)c2cnc3ccccc3n2)cc1.
What is the InChIKey of 2-[(E)-1,2-dibromo-2-(4-chlorophenyl)ethenyl]quinoxaline?
The InChIKey is CTUUCQFZGCQWSH-FOCLMDBBSA-N. The full InChI is InChI=1S/C16H9Br2ClN2/c17-15(10-5-7-11(19)8-6-10)16(18)14-9-20-12-3-1-2-4-13(12)21-14/h1-9H/b16-15+.
What are the key properties of 2-[(E)-1,2-dibromo-2-(4-chlorophenyl)ethenyl]quinoxaline?
2-[(E)-1,2-dibromo-2-(4-chlorophenyl)ethenyl]quinoxaline has a molecular weight of 424.52 g/mol, XLogP of 5.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-1,2-dibromo-2-(4-chlorophenyl)ethenyl]quinoxaline is sourced from PubChem (CID 10598419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).