C28H30O4 — CID 10598739
8-[(4-hydroxyphenyl)methyl]-5,7-dimethoxy-1-(3-methylbut-2-enyl)-9,10-dihydrophenanthren-2-ol (PubChem CID 10598739) has the molecular formula C28H30O4 and a molecular weight of 430.54 g/mol. Its IUPAC name is 8-[(4-hydroxyphenyl)methyl]-5,7-dimethoxy-1-(3-methylbut-2-enyl)-9,10-dihydrophenanthren-2-ol.
| Compound Name | 8-[(4-hydroxyphenyl)methyl]-5,7-dimethoxy-1-(3-methylbut-2-enyl)-9,10-dihydrophenanthren-2-ol |
|---|---|
| PubChem CID | 10598739 |
| Molecular Formula | C28H30O4 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 8-[(4-hydroxyphenyl)methyl]-5,7-dimethoxy-1-(3-methylbut-2-enyl)-9,10-dihydrophenanthren-2-ol |
| SMILES | COc1cc(OC)c2c(c1Cc1ccc(O)cc1)CCc1c-2ccc(O)c1CC=C(C)C |
| InChI | InChI=1S/C28H30O4/c1-17(2)5-10-21-20-11-12-23-24(15-18-6-8-19(29)9-7-18)26(31-3)16-27(32-4)28(23)22(20)13-14-25(21)30/h5-9,13-14,16,29-30H,10-12,15H2,1-4H3 |
| InChIKey | HMLGVGNOYWHUGH-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|