C24H44F2O2Si — CID 10598765
(6R)-6-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-3,3-difluoro-2-methylheptan-2-ol (PubChem CID 10598765) has the molecular formula C24H44F2O2Si and a molecular weight of 430.70 g/mol. Its IUPAC name is (6R)-6-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-3,3-difluoro-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-3,3-difluoro-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 10598765 |
| Molecular Formula | C24H44F2O2Si |
| Molecular Weight | 430.70 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | (6R)-6-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-3,3-difluoro-2-methylheptan-2-ol |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)C([C@H](C)CCC(F)(F)C(C)(C)O)=CC[C@@H]12 |
| InChI | InChI=1S/C24H44F2O2Si/c1-8-29(9-2,10-3)28-21-12-11-16-23(7)19(13-14-20(21)23)18(4)15-17-24(25,26)22(5,6)27/h13,18,20-21,27H,8-12,14-17H2,1-7H3/t18-,20+,21+,23-/m1/s1 |
| InChIKey | LTJDZHXMCHJSIP-LCKKVJLRSA-N |
| XLogP | 7.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.70 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|