About 1,5-bis[di(propan-2-yloxy)phosphoryl]-1,1-difluoropentane
1,5-bis[di(propan-2-yloxy)phosphoryl]-1,1-difluoropentane (PubChem CID 10599039) has the molecular formula C17H36F2O6P2
and a molecular weight of 436.41 g/mol. Its IUPAC name is 1,5-bis[di(propan-2-yloxy)phosphoryl]-1,1-difluoropentane.
Molecular Properties
| Compound Name | 1,5-bis[di(propan-2-yloxy)phosphoryl]-1,1-difluoropentane |
| PubChem CID | 10599039 |
| Molecular Formula | C17H36F2O6P2 |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 1,5-bis[di(propan-2-yloxy)phosphoryl]-1,1-difluoropentane |
| SMILES | CC(C)OP(=O)(CCCCC(F)(F)P(=O)(OC(C)C)OC(C)C)OC(C)C |
| InChI | InChI=1S/C17H36F2O6P2/c1-13(2)22-26(20,23-14(3)4)12-10-9-11-17(18,19)27(21,24-15(5)6)25-16(7)8/h13-16H,9-12H2,1-8H3 |
| InChIKey | PKLGXJSYYNQZHI-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,5-bis[di(propan-2-yloxy)phosphoryl]-1,1-difluoropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis[di(propan-2-yloxy)phosphoryl]-1,1-difluoropentane?
The IUPAC name of 1,5-bis[di(propan-2-yloxy)phosphoryl]-1,1-difluoropentane (CID 10599039) is 1,5-bis[di(propan-2-yloxy)phosphoryl]-1,1-difluoropentane.
What is the SMILES notation for 1,5-bis[di(propan-2-yloxy)phosphoryl]-1,1-difluoropentane?
The canonical SMILES for 1,5-bis[di(propan-2-yloxy)phosphoryl]-1,1-difluoropentane is CC(C)OP(=O)(CCCCC(F)(F)P(=O)(OC(C)C)OC(C)C)OC(C)C.
What is the InChIKey of 1,5-bis[di(propan-2-yloxy)phosphoryl]-1,1-difluoropentane?
The InChIKey is PKLGXJSYYNQZHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36F2O6P2/c1-13(2)22-26(20,23-14(3)4)12-10-9-11-17(18,19)27(21,24-15(5)6)25-16(7)8/h13-16H,9-12H2,1-8H3.
What are the key properties of 1,5-bis[di(propan-2-yloxy)phosphoryl]-1,1-difluoropentane?
1,5-bis[di(propan-2-yloxy)phosphoryl]-1,1-difluoropentane has a molecular weight of 436.41 g/mol, XLogP of 6.84, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis[di(propan-2-yloxy)phosphoryl]-1,1-difluoropentane is sourced from PubChem (CID 10599039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).