About 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methylchromen-4-one
7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methylchromen-4-one (PubChem CID 10599046) has the molecular formula C25H25FN2O4
and a molecular weight of 436.48 g/mol. Its IUPAC name is 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methylchromen-4-one.
Molecular Properties
| Compound Name | 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methylchromen-4-one |
| PubChem CID | 10599046 |
| Molecular Formula | C25H25FN2O4 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methylchromen-4-one |
| SMILES | Cc1coc2cc(OCCCN3CCC(c4noc5cc(F)ccc45)CC3)ccc2c1=O |
| InChI | InChI=1S/C25H25FN2O4/c1-16-15-31-22-14-19(4-6-21(22)25(16)29)30-12-2-9-28-10-7-17(8-11-28)24-20-5-3-18(26)13-23(20)32-27-24/h3-6,13-15,17H,2,7-12H2,1H3 |
| InChIKey | YJKSMRSCQYIHMX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 68.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methylchromen-4-one?
The IUPAC name of 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methylchromen-4-one (CID 10599046) is 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methylchromen-4-one.
What is the SMILES notation for 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methylchromen-4-one?
The canonical SMILES for 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methylchromen-4-one is Cc1coc2cc(OCCCN3CCC(c4noc5cc(F)ccc45)CC3)ccc2c1=O.
What is the InChIKey of 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methylchromen-4-one?
The InChIKey is YJKSMRSCQYIHMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25FN2O4/c1-16-15-31-22-14-19(4-6-21(22)25(16)29)30-12-2-9-28-10-7-17(8-11-28)24-20-5-3-18(26)13-23(20)32-27-24/h3-6,13-15,17H,2,7-12H2,1H3.
What are the key properties of 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methylchromen-4-one?
7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methylchromen-4-one has a molecular weight of 436.48 g/mol, XLogP of 5.03, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methylchromen-4-one is sourced from PubChem (CID 10599046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).