C23H27NO8 — CID 10599452
N-[(10S)-3,4,5,14,16-pentamethoxy-15-oxo-11-oxatricyclo[10.5.0.02,7]heptadeca-1(12),2,4,6,13,16-hexaen-10-yl]acetamide (PubChem CID 10599452) has the molecular formula C23H27NO8 and a molecular weight of 445.47 g/mol. Its IUPAC name is N-[(10S)-3,4,5,14,16-pentamethoxy-15-oxo-11-oxatricyclo[10.5.0.02,7]heptadeca-1(12),2,4,6,13,16-hexaen-10-yl]acetamide.
| Compound Name | N-[(10S)-3,4,5,14,16-pentamethoxy-15-oxo-11-oxatricyclo[10.5.0.02,7]heptadeca-1(12),2,4,6,13,16-hexaen-10-yl]acetamide |
|---|---|
| PubChem CID | 10599452 |
| Molecular Formula | C23H27NO8 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | N-[(10S)-3,4,5,14,16-pentamethoxy-15-oxo-11-oxatricyclo[10.5.0.02,7]heptadeca-1(12),2,4,6,13,16-hexaen-10-yl]acetamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1cc(OC)c(=O)c(OC)cc1O[C@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C23H27NO8/c1-12(25)24-19-8-7-13-9-18(29-4)22(30-5)23(31-6)20(13)14-10-16(27-2)21(26)17(28-3)11-15(14)32-19/h9-11,19H,7-8H2,1-6H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | CTJAXHIPBWHPRW-IBGZPJMESA-N |
| XLogP | 2.54 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |