About (4R)-4-[5-(1,3-benzodioxol-5-ylmethoxy)-2-cyanophenoxy]-4-(2-methylphenyl)butanoic acid
(4R)-4-[5-(1,3-benzodioxol-5-ylmethoxy)-2-cyanophenoxy]-4-(2-methylphenyl)butanoic acid (PubChem CID 10599453) has the molecular formula C26H23NO6
and a molecular weight of 445.47 g/mol. Its IUPAC name is (4R)-4-[5-(1,3-benzodioxol-5-ylmethoxy)-2-cyanophenoxy]-4-(2-methylphenyl)butanoic acid.
Molecular Properties
| Compound Name | (4R)-4-[5-(1,3-benzodioxol-5-ylmethoxy)-2-cyanophenoxy]-4-(2-methylphenyl)butanoic acid |
| PubChem CID | 10599453 |
| Molecular Formula | C26H23NO6 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | (4R)-4-[5-(1,3-benzodioxol-5-ylmethoxy)-2-cyanophenoxy]-4-(2-methylphenyl)butanoic acid |
| SMILES | Cc1ccccc1[C@@H](CCC(=O)O)Oc1cc(OCc2ccc3c(c2)OCO3)ccc1C#N |
| InChI | InChI=1S/C26H23NO6/c1-17-4-2-3-5-21(17)22(10-11-26(28)29)33-24-13-20(8-7-19(24)14-27)30-15-18-6-9-23-25(12-18)32-16-31-23/h2-9,12-13,22H,10-11,15-16H2,1H3,(H,28,29)/t22-/m1/s1 |
| InChIKey | FYSOOPQBBYQVJU-JOCHJYFZSA-N |
| XLogP | 5.16 |
| TPSA | 98.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4R)-4-[5-(1,3-benzodioxol-5-ylmethoxy)-2-cyanophenoxy]-4-(2-methylphenyl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[5-(1,3-benzodioxol-5-ylmethoxy)-2-cyanophenoxy]-4-(2-methylphenyl)butanoic acid?
The IUPAC name of (4R)-4-[5-(1,3-benzodioxol-5-ylmethoxy)-2-cyanophenoxy]-4-(2-methylphenyl)butanoic acid (CID 10599453) is (4R)-4-[5-(1,3-benzodioxol-5-ylmethoxy)-2-cyanophenoxy]-4-(2-methylphenyl)butanoic acid.
What is the SMILES notation for (4R)-4-[5-(1,3-benzodioxol-5-ylmethoxy)-2-cyanophenoxy]-4-(2-methylphenyl)butanoic acid?
The canonical SMILES for (4R)-4-[5-(1,3-benzodioxol-5-ylmethoxy)-2-cyanophenoxy]-4-(2-methylphenyl)butanoic acid is Cc1ccccc1[C@@H](CCC(=O)O)Oc1cc(OCc2ccc3c(c2)OCO3)ccc1C#N.
What is the InChIKey of (4R)-4-[5-(1,3-benzodioxol-5-ylmethoxy)-2-cyanophenoxy]-4-(2-methylphenyl)butanoic acid?
The InChIKey is FYSOOPQBBYQVJU-JOCHJYFZSA-N. The full InChI is InChI=1S/C26H23NO6/c1-17-4-2-3-5-21(17)22(10-11-26(28)29)33-24-13-20(8-7-19(24)14-27)30-15-18-6-9-23-25(12-18)32-16-31-23/h2-9,12-13,22H,10-11,15-16H2,1H3,(H,28,29)/t22-/m1/s1.
What are the key properties of (4R)-4-[5-(1,3-benzodioxol-5-ylmethoxy)-2-cyanophenoxy]-4-(2-methylphenyl)butanoic acid?
(4R)-4-[5-(1,3-benzodioxol-5-ylmethoxy)-2-cyanophenoxy]-4-(2-methylphenyl)butanoic acid has a molecular weight of 445.47 g/mol, XLogP of 5.16, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[5-(1,3-benzodioxol-5-ylmethoxy)-2-cyanophenoxy]-4-(2-methylphenyl)butanoic acid is sourced from PubChem (CID 10599453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).