C23H22N4O6 — CID 10599655
6-(3-azidopropyl)-2,3,8,9-tetramethoxyindeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 10599655) has the molecular formula C23H22N4O6 and a molecular weight of 450.45 g/mol. Its IUPAC name is 6-(3-azidopropyl)-2,3,8,9-tetramethoxyindeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-(3-azidopropyl)-2,3,8,9-tetramethoxyindeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 10599655 |
| Molecular Formula | C23H22N4O6 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 6-(3-azidopropyl)-2,3,8,9-tetramethoxyindeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | COc1cc2c(cc1OC)-c1c(c3cc(OC)c(OC)cc3c(=O)n1CCCN=[N+]=[N-])C2=O |
| InChI | InChI=1S/C23H22N4O6/c1-30-16-8-12-15(11-19(16)33-4)23(29)27(7-5-6-25-26-24)21-13-9-17(31-2)18(32-3)10-14(13)22(28)20(12)21/h8-11H,5-7H2,1-4H3 |
| InChIKey | UHRSAHQXCWIMLP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 124.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|