C20H31ClOTe — CID 10599664
butyl-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]-phenyltellanium chloride (PubChem CID 10599664) has the molecular formula C20H31ClOTe and a molecular weight of 450.52 g/mol. Its IUPAC name is butyl-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]-phenyltellanium chloride.
| Compound Name | butyl-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]-phenyltellanium chloride |
|---|---|
| PubChem CID | 10599664 |
| Molecular Formula | C20H31ClOTe |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | butyl-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]-phenyltellanium chloride |
| SMILES | CCCC[Te+](C[C@]12CC[C@H](C[C@H]1O)C2(C)C)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C20H31OTe.ClH/c1-4-5-13-22(17-9-7-6-8-10-17)15-20-12-11-16(14-18(20)21)19(20,2)3;/h6-10,16,18,21H,4-5,11-15H2,1-3H3;1H/q+1;/p-1/t16-,18-,20-;/m1./s1 |
| InChIKey | UMCBYQDUWJOJAF-BUDAEHISSA-M |
| XLogP | 1.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|