C22H28O10 — CID 10599721
(1S,2S,7S,8S)-7,11-bis(1,3-dioxolan-2-yl)-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione (PubChem CID 10599721) has the molecular formula C22H28O10 and a molecular weight of 452.46 g/mol. Its IUPAC name is (1S,2S,7S,8S)-7,11-bis(1,3-dioxolan-2-yl)-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione.
| Compound Name | (1S,2S,7S,8S)-7,11-bis(1,3-dioxolan-2-yl)-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
|---|---|
| PubChem CID | 10599721 |
| Molecular Formula | C22H28O10 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | (1S,2S,7S,8S)-7,11-bis(1,3-dioxolan-2-yl)-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
| SMILES | COC1(OC)C(=O)[C@H]2C=C(C3OCCO3)[C@@H]1[C@@H]1C(OC)(OC)C(=O)C=C[C@]21C1OCCO1 |
| InChI | InChI=1S/C22H28O10/c1-25-21(26-2)14(23)5-6-20(19-31-9-10-32-19)13-11-12(18-29-7-8-30-18)15(16(20)21)22(27-3,28-4)17(13)24/h5-6,11,13,15-16,18-19H,7-10H2,1-4H3/t13-,15-,16+,20+/m1/s1 |
| InChIKey | ZFMKGFWWLRFBOK-NEVJAFOQSA-N |
| XLogP | 0.21 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|