About methyl (E,2R)-6-azido-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate
methyl (E,2R)-6-azido-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate (PubChem CID 10599739) has the molecular formula C28H28N4O2
and a molecular weight of 452.56 g/mol. Its IUPAC name is methyl (E,2R)-6-azido-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate.
Molecular Properties
| Compound Name | methyl (E,2R)-6-azido-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate |
| PubChem CID | 10599739 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | methyl (E,2R)-6-azido-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate |
| SMILES | COC(=O)[C@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(C)(C)/C=C/CN=[N+]=[N-] |
| InChI | InChI=1S/C28H28N4O2/c1-27(2,18-11-19-30-32-29)25(26(33)34-3)31-28(20-12-5-4-6-13-20)23-16-9-7-14-21(23)22-15-8-10-17-24(22)28/h4-18,25,31H,19H2,1-3H3/b18-11+/t25-/m0/s1 |
| InChIKey | NVQIFLFTOCEEGK-AIHHMALZSA-N |
| XLogP | 5.98 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze methyl (E,2R)-6-azido-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E,2R)-6-azido-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate?
The IUPAC name of methyl (E,2R)-6-azido-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate (CID 10599739) is methyl (E,2R)-6-azido-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate.
What is the SMILES notation for methyl (E,2R)-6-azido-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate?
The canonical SMILES for methyl (E,2R)-6-azido-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate is COC(=O)[C@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(C)(C)/C=C/CN=[N+]=[N-].
What is the InChIKey of methyl (E,2R)-6-azido-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate?
The InChIKey is NVQIFLFTOCEEGK-AIHHMALZSA-N. The full InChI is InChI=1S/C28H28N4O2/c1-27(2,18-11-19-30-32-29)25(26(33)34-3)31-28(20-12-5-4-6-13-20)23-16-9-7-14-21(23)22-15-8-10-17-24(22)28/h4-18,25,31H,19H2,1-3H3/b18-11+/t25-/m0/s1.
What are the key properties of methyl (E,2R)-6-azido-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate?
methyl (E,2R)-6-azido-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate has a molecular weight of 452.56 g/mol, XLogP of 5.98, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E,2R)-6-azido-3,3-dimethyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate is sourced from PubChem (CID 10599739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).