C26H48O4Si — CID 10599755
(2R,3R)-2-[(2R,3R,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5,8-trimethylnon-7-enyl]-3-ethyl-2,3-dihydropyran-6-one (PubChem CID 10599755) has the molecular formula C26H48O4Si and a molecular weight of 452.75 g/mol. Its IUPAC name is (2R,3R)-2-[(2R,3R,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5,8-trimethylnon-7-enyl]-3-ethyl-2,3-dihydropyran-6-one.
| Compound Name | (2R,3R)-2-[(2R,3R,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5,8-trimethylnon-7-enyl]-3-ethyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 10599755 |
| Molecular Formula | C26H48O4Si |
| Molecular Weight | 452.75 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (2R,3R)-2-[(2R,3R,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5,8-trimethylnon-7-enyl]-3-ethyl-2,3-dihydropyran-6-one |
| SMILES | CC[C@@H]1C=CC(=O)O[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](OC)[C@@H](C)CC=C(C)C |
| InChI | InChI=1S/C26H48O4Si/c1-12-21-15-16-24(27)29-23(21)17-22(30-31(10,11)26(6,7)8)20(5)25(28-9)19(4)14-13-18(2)3/h13,15-16,19-23,25H,12,14,17H2,1-11H3/t19-,20-,21+,22+,23+,25+/m0/s1 |
| InChIKey | CXFBMLCZQAUAKT-JSBYLQNGSA-N |
| XLogP | 6.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.75 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|