C18H37BrO4Si2 — CID 10599787
(1R,2R,5S,6S)-4-bromo-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohex-3-ene-1,2-diol (PubChem CID 10599787) has the molecular formula C18H37BrO4Si2 and a molecular weight of 453.57 g/mol. Its IUPAC name is (1R,2R,5S,6S)-4-bromo-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohex-3-ene-1,2-diol.
| Compound Name | (1R,2R,5S,6S)-4-bromo-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 10599787 |
| Molecular Formula | C18H37BrO4Si2 |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (1R,2R,5S,6S)-4-bromo-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohex-3-ene-1,2-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)C=C(Br)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H37BrO4Si2/c1-17(2,3)24(7,8)22-15-12(19)11-13(20)14(21)16(15)23-25(9,10)18(4,5)6/h11,13-16,20-21H,1-10H3/t13-,14-,15-,16+/m1/s1 |
| InChIKey | SDOBNDYQZJZHSY-FPCVCCKLSA-N |
| XLogP | 4.78 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|