About 3-ethyl-2,4-dimethyl-1H-pyrrole
3-ethyl-2,4-dimethyl-1H-pyrrole (PubChem CID 10600) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is 3-ethyl-2,4-dimethyl-1H-pyrrole.
Molecular Properties
| Compound Name | 3-ethyl-2,4-dimethyl-1H-pyrrole |
| PubChem CID | 10600 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 3-ethyl-2,4-dimethyl-1H-pyrrole |
| SMILES | CCc1c(C)c[nH]c1C |
| InChI | InChI=1S/C8H13N/c1-4-8-6(2)5-9-7(8)3/h5,9H,4H2,1-3H3 |
| InChIKey | ZEBBLOXDLGIMEG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-ethyl-2,4-dimethyl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,4-dimethyl-1H-pyrrole?
The IUPAC name of 3-ethyl-2,4-dimethyl-1H-pyrrole (CID 10600) is 3-ethyl-2,4-dimethyl-1H-pyrrole.
What is the SMILES notation for 3-ethyl-2,4-dimethyl-1H-pyrrole?
The canonical SMILES for 3-ethyl-2,4-dimethyl-1H-pyrrole is CCc1c(C)c[nH]c1C.
What is the InChIKey of 3-ethyl-2,4-dimethyl-1H-pyrrole?
The InChIKey is ZEBBLOXDLGIMEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N/c1-4-8-6(2)5-9-7(8)3/h5,9H,4H2,1-3H3.
What are the key properties of 3-ethyl-2,4-dimethyl-1H-pyrrole?
3-ethyl-2,4-dimethyl-1H-pyrrole has a molecular weight of 123.20 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,4-dimethyl-1H-pyrrole is sourced from PubChem (CID 10600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).